C20H15F3N5O5+ — CID 163331271
2-amino-1-(4-nitrophenyl)-5H-pyrido[3,2-b]indol-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 163331271) has the molecular formula C20H15F3N5O5+ and a molecular weight of 462.36 g/mol. Its IUPAC name is 2-amino-1-(4-nitrophenyl)-5H-pyrido[3,2-b]indol-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-1-(4-nitrophenyl)-5H-pyrido[3,2-b]indol-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 163331271 |
| Molecular Formula | C20H15F3N5O5+ |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-amino-1-(4-nitrophenyl)-5H-pyrido[3,2-b]indol-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cc2[nH]c3ccccc3c2[n+](-c2ccc([N+](=O)[O-])cc2)c1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H13N5O3.C2HF3O2/c19-17-13(18(20)24)9-15-16(12-3-1-2-4-14(12)21-15)22(17)10-5-7-11(8-6-10)23(25)26;3-2(4,5)1(6)7/h1-9H,(H4,19,20,21,24);(H,6,7)/p+1 |
| InChIKey | NYKRSONWNJTRKP-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 169.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|