C15H10F3NO2S — CID 71410510
10H-acridine-9-thione;2,2,2-trifluoroacetic acid (PubChem CID 71410510) has the molecular formula C15H10F3NO2S and a molecular weight of 325.31 g/mol. Its IUPAC name is 10H-acridine-9-thione;2,2,2-trifluoroacetic acid.
| Compound Name | 10H-acridine-9-thione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71410510 |
| Molecular Formula | C15H10F3NO2S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 10H-acridine-9-thione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.S=c1c2ccccc2[nH]c2ccccc12 |
| InChI | InChI=1S/C13H9NS.C2HF3O2/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13;3-2(4,5)1(6)7/h1-8H,(H,14,15);(H,6,7) |
| InChIKey | YSRLCUNQYATLMG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|