C16H10F3NO3S — CID 175709241
1-[2-(benzenesulfonyl)-1H-indol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 175709241) has the molecular formula C16H10F3NO3S and a molecular weight of 353.32 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)-1H-indol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-(benzenesulfonyl)-1H-indol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 175709241 |
| Molecular Formula | C16H10F3NO3S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-[2-(benzenesulfonyl)-1H-indol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1c(S(=O)(=O)c2ccccc2)[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H10F3NO3S/c17-16(18,19)14(21)13-11-8-4-5-9-12(11)20-15(13)24(22,23)10-6-2-1-3-7-10/h1-9,20H |
| InChIKey | RBKQHYASLARPBN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |