C23H20N4O4S — CID 89052526
2-(benzenesulfonyl)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-1H-indole-3-carboxamide (PubChem CID 89052526) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-1H-indole-3-carboxamide.
| Compound Name | 2-(benzenesulfonyl)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 89052526 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(benzenesulfonyl)-N-[[4-(N'-hydroxycarbamimidoyl)phenyl]methyl]-1H-indole-3-carboxamide |
| SMILES | NC(=NO)c1ccc(CNC(=O)c2c(S(=O)(=O)c3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H20N4O4S/c24-21(27-29)16-12-10-15(11-13-16)14-25-22(28)20-18-8-4-5-9-19(18)26-23(20)32(30,31)17-6-2-1-3-7-17/h1-13,26,29H,14H2,(H2,24,27)(H,25,28) |
| InChIKey | OKJLXVHAVITWTQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|