C25H17N3O6 — CID 54704875
4-hydroxy-3-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)-(3-nitrophenyl)methyl]-1H-quinolin-2-one (PubChem CID 54704875) has the molecular formula C25H17N3O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)-(3-nitrophenyl)methyl]-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)-(3-nitrophenyl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54704875 |
| Molecular Formula | C25H17N3O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)-(3-nitrophenyl)methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2c(O)c1C(c1cccc([N+](=O)[O-])c1)c1c(O)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C25H17N3O6/c29-22-15-8-1-3-10-17(15)26-24(31)20(22)19(13-6-5-7-14(12-13)28(33)34)21-23(30)16-9-2-4-11-18(16)27-25(21)32/h1-12,19H,(H2,26,29,31)(H2,27,30,32) |
| InChIKey | MUSYENVMJMAGBD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|