C22H21N3O4 — CID 18615237
2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-(3-nitrophenyl)ethanol (PubChem CID 18615237) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-(3-nitrophenyl)ethanol.
| Compound Name | 2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-(3-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 18615237 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-(3-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1cccc(C(O)CNCCOc2ccc3c(c2)[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C22H21N3O4/c26-22(15-4-3-5-16(12-15)25(27)28)14-23-10-11-29-17-8-9-19-18-6-1-2-7-20(18)24-21(19)13-17/h1-9,12-13,22-24,26H,10-11,14H2 |
| InChIKey | MLUIHKSMGSSIAZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|