C24H24N4O6S — CID 142649023
5-[(1R)-2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methyl-2-oxo-1,3-benzoxazole-3-sulfonamide (PubChem CID 142649023) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is 5-[(1R)-2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methyl-2-oxo-1,3-benzoxazole-3-sulfonamide.
| Compound Name | 5-[(1R)-2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methyl-2-oxo-1,3-benzoxazole-3-sulfonamide |
|---|---|
| PubChem CID | 142649023 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 5-[(1R)-2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methyl-2-oxo-1,3-benzoxazole-3-sulfonamide |
| SMILES | CNS(=O)(=O)n1c(=O)oc2ccc([C@@H](O)CNCCOc3ccc4c(c3)[nH]c3ccccc34)cc21 |
| InChI | InChI=1S/C24H24N4O6S/c1-25-35(31,32)28-21-12-15(6-9-23(21)34-24(28)30)22(29)14-26-10-11-33-16-7-8-18-17-4-2-3-5-19(17)27-20(18)13-16/h2-9,12-13,22,25-27,29H,10-11,14H2,1H3/t22-/m0/s1 |
| InChIKey | GYOCLYNZCXJNJP-QFIPXVFZSA-N |
| XLogP | 2.24 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|