C31H33N3O5S — CID 18615207
5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N,N-dimethyl-2-phenylmethoxybenzenesulfonamide (PubChem CID 18615207) has the molecular formula C31H33N3O5S and a molecular weight of 559.69 g/mol. Its IUPAC name is 5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N,N-dimethyl-2-phenylmethoxybenzenesulfonamide.
| Compound Name | 5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N,N-dimethyl-2-phenylmethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 18615207 |
| Molecular Formula | C31H33N3O5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-hydroxyethyl]-N,N-dimethyl-2-phenylmethoxybenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(O)CNCCOc2ccc3c(c2)[nH]c2ccccc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H33N3O5S/c1-34(2)40(36,37)31-18-23(12-15-30(31)39-21-22-8-4-3-5-9-22)29(35)20-32-16-17-38-24-13-14-26-25-10-6-7-11-27(25)33-28(26)19-24/h3-15,18-19,29,32-33,35H,16-17,20-21H2,1-2H3 |
| InChIKey | YTKRHRWXEIJNOF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|