C27H23N5O4 — CID 126375898
5-(4-methylphenyl)-4-[[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]-(3-nitrophenyl)methyl]-1,2-dihydropyrazol-3-one (PubChem CID 126375898) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-[[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]-(3-nitrophenyl)methyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-(4-methylphenyl)-4-[[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]-(3-nitrophenyl)methyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 126375898 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 5-(4-methylphenyl)-4-[[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]-(3-nitrophenyl)methyl]-1,2-dihydropyrazol-3-one |
| SMILES | Cc1ccc(-c2[nH][nH]c(=O)c2C(c2cccc([N+](=O)[O-])c2)c2c(-c3ccc(C)cc3)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C27H23N5O4/c1-15-6-10-17(11-7-15)24-22(26(33)30-28-24)21(19-4-3-5-20(14-19)32(35)36)23-25(29-31-27(23)34)18-12-8-16(2)9-13-18/h3-14,21H,1-2H3,(H2,28,30,33)(H2,29,31,34) |
| InChIKey | GOORTGVUQNWCKS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|