C34H27I2N5O5 — CID 126374275
4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]methyl]-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 126374275) has the molecular formula C34H27I2N5O5 and a molecular weight of 839.43 g/mol. Its IUPAC name is 4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]methyl]-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]methyl]-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 126374275 |
| Molecular Formula | C34H27I2N5O5 |
| Molecular Weight | 839.43 g/mol |
| Exact Mass | 839.01 |
| IUPAC Name | 4-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-[3-(4-methylphenyl)-5-oxo-1,2-dihydropyrazol-4-yl]methyl]-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | Cc1ccc(-c2[nH][nH]c(=O)c2C(c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)c2c(-c3ccc(C)cc3)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C34H27I2N5O5/c1-18-3-9-21(10-4-18)30-28(33(42)39-37-30)27(29-31(38-40-34(29)43)22-11-5-19(2)6-12-22)23-15-25(35)32(26(36)16-23)46-17-20-7-13-24(14-8-20)41(44)45/h3-16,27H,17H2,1-2H3,(H2,37,39,42)(H2,38,40,43) |
| InChIKey | SYNCPQUDYIQUID-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.43 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|