C24H19IN2O4 — CID 23885135
3-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 23885135) has the molecular formula C24H19IN2O4 and a molecular weight of 526.33 g/mol. Its IUPAC name is 3-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | 3-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 23885135 |
| Molecular Formula | C24H19IN2O4 |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 3-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2ccc(C)cc2)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H19IN2O4/c1-16-3-7-19(8-4-16)20(14-26)11-18-12-22(25)24(23(13-18)30-2)31-15-17-5-9-21(10-6-17)27(28)29/h3-13H,15H2,1-2H3 |
| InChIKey | SSDICIACVCKCHM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|