C22H13I2N3O5 — CID 126207380
(E)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126207380) has the molecular formula C22H13I2N3O5 and a molecular weight of 653.17 g/mol. Its IUPAC name is (E)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126207380 |
| Molecular Formula | C22H13I2N3O5 |
| Molecular Weight | 653.17 g/mol |
| Exact Mass | 652.89 |
| IUPAC Name | (E)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13I2N3O5/c23-20-10-15(9-17(12-25)16-3-7-19(8-4-16)27(30)31)11-21(24)22(20)32-13-14-1-5-18(6-2-14)26(28)29/h1-11H,13H2/b17-9- |
| InChIKey | KCUIKAJEFIUXJI-MFOYZWKCSA-N |
| XLogP | 6.36 |
| TPSA | 119.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.17 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|