C17H11I2N3O5 — CID 126055186
(5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126055186) has the molecular formula C17H11I2N3O5 and a molecular weight of 591.10 g/mol. Its IUPAC name is (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126055186 |
| Molecular Formula | C17H11I2N3O5 |
| Molecular Weight | 591.10 g/mol |
| Exact Mass | 590.88 |
| IUPAC Name | (5E)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)N1 |
| InChI | InChI=1S/C17H11I2N3O5/c18-12-5-10(7-14-16(23)21-17(24)20-14)6-13(19)15(12)27-8-9-1-3-11(4-2-9)22(25)26/h1-7H,8H2,(H2,20,21,23,24)/b14-7+ |
| InChIKey | TZNKOEUBHDJNIU-VGOFMYFVSA-N |
| XLogP | 3.56 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.10 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|