C24H15N3O2 — CID 56641148
7-(4-nitrophenyl)-5,12-dihydroindolo[3,2-a]carbazole (PubChem CID 56641148) has the molecular formula C24H15N3O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-5,12-dihydroindolo[3,2-a]carbazole.
| Compound Name | 7-(4-nitrophenyl)-5,12-dihydroindolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 56641148 |
| Molecular Formula | C24H15N3O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 7-(4-nitrophenyl)-5,12-dihydroindolo[3,2-a]carbazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3[nH]c4ccccc4c3c3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C24H15N3O2/c28-27(29)15-11-9-14(10-12-15)18-13-21-23(17-6-2-3-7-19(17)25-21)24-22(18)16-5-1-4-8-20(16)26-24/h1-13,25-26H |
| InChIKey | MGQMVTUJVMQFEF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|