C19H22N2O — CID 15478647
(15R,18R,20R)-3,11,12,14,15,16,17,18,19,20-decahydroyohimban-18-ol (PubChem CID 15478647) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (15R,18R,20R)-3,11,12,14,15,16,17,18,19,20-decahydroyohimban-18-ol.
| Compound Name | (15R,18R,20R)-3,11,12,14,15,16,17,18,19,20-decahydroyohimban-18-ol |
|---|---|
| PubChem CID | 15478647 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (15R,18R,20R)-3,11,12,14,15,16,17,18,19,20-decahydroyohimban-18-ol |
| SMILES | O[C@@H]1CC[C@H]2CN3CCc4c([nH]c5ccccc45)C3=C[C@@H]2C1 |
| InChI | InChI=1S/C19H22N2O/c22-14-6-5-12-11-21-8-7-16-15-3-1-2-4-17(15)20-19(16)18(21)10-13(12)9-14/h1-4,10,12-14,20,22H,5-9,11H2/t12-,13-,14+/m0/s1 |
| InChIKey | DCJJGKBUJOVLMR-MELADBBJSA-N |
| XLogP | 3.16 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |