C22H18N2OS — CID 136811326
1-(naphthalen-1-ylsulfinylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 136811326) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(naphthalen-1-ylsulfinylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 1-(naphthalen-1-ylsulfinylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 136811326 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(naphthalen-1-ylsulfinylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | O=S(CC1=NCCc2c1[nH]c1ccccc21)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H18N2OS/c25-26(21-11-5-7-15-6-1-2-8-16(15)21)14-20-22-18(12-13-23-20)17-9-3-4-10-19(17)24-22/h1-11,24H,12-14H2 |
| InChIKey | ONZRUHOPEMLNPZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|