C23H21N3O4 — CID 102369057
methyl (E)-3-[(5Z)-6-(4-nitrophenyl)-1,2,4,7-tetrahydroazocino[5,4-b]indol-3-yl]prop-2-enoate (PubChem CID 102369057) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is methyl (E)-3-[(5Z)-6-(4-nitrophenyl)-1,2,4,7-tetrahydroazocino[5,4-b]indol-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(5Z)-6-(4-nitrophenyl)-1,2,4,7-tetrahydroazocino[5,4-b]indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102369057 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl (E)-3-[(5Z)-6-(4-nitrophenyl)-1,2,4,7-tetrahydroazocino[5,4-b]indol-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/N1C/C=C(/c2ccc([N+](=O)[O-])cc2)c2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C23H21N3O4/c1-30-22(27)12-15-25-13-10-18(16-6-8-17(9-7-16)26(28)29)23-20(11-14-25)19-4-2-3-5-21(19)24-23/h2-10,12,15,24H,11,13-14H2,1H3/b15-12+,18-10- |
| InChIKey | JBXFWTJLJVGDJH-HPINHASASA-N |
| XLogP | 4.05 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|