C20H22N2O4 — CID 11824391
methyl (6E)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4,5,8-tetrahydro-1H-azonino[5,4-b]indole-7-carboxylate (PubChem CID 11824391) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl (6E)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4,5,8-tetrahydro-1H-azonino[5,4-b]indole-7-carboxylate.
| Compound Name | methyl (6E)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4,5,8-tetrahydro-1H-azonino[5,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 11824391 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl (6E)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4,5,8-tetrahydro-1H-azonino[5,4-b]indole-7-carboxylate |
| SMILES | COC(=O)/C=C/N1CC/C=C(/C(=O)OC)c2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-18(23)10-13-22-11-5-7-16(20(24)26-2)19-15(9-12-22)14-6-3-4-8-17(14)21-19/h3-4,6-8,10,13,21H,5,9,11-12H2,1-2H3/b13-10+,16-7+ |
| InChIKey | PQLUECQIMPLIHX-PCXSKJIQSA-N |
| XLogP | 2.66 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|