C21H20N2O7 — CID 54699416
dimethyl (3E)-2-hydroxy-3-(2-methoxy-2-oxoethylidene)-6,11-dihydro-5H-indolizino[8,7-b]indole-1,11b-dicarboxylate (PubChem CID 54699416) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is dimethyl (3E)-2-hydroxy-3-(2-methoxy-2-oxoethylidene)-6,11-dihydro-5H-indolizino[8,7-b]indole-1,11b-dicarboxylate.
| Compound Name | dimethyl (3E)-2-hydroxy-3-(2-methoxy-2-oxoethylidene)-6,11-dihydro-5H-indolizino[8,7-b]indole-1,11b-dicarboxylate |
|---|---|
| PubChem CID | 54699416 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | dimethyl (3E)-2-hydroxy-3-(2-methoxy-2-oxoethylidene)-6,11-dihydro-5H-indolizino[8,7-b]indole-1,11b-dicarboxylate |
| SMILES | COC(=O)/C=C1\C(O)=C(C(=O)OC)C2(C(=O)OC)c3[nH]c4ccccc4c3CCN12 |
| InChI | InChI=1S/C21H20N2O7/c1-28-15(24)10-14-17(25)16(19(26)29-2)21(20(27)30-3)18-12(8-9-23(14)21)11-6-4-5-7-13(11)22-18/h4-7,10,22,25H,8-9H2,1-3H3/b14-10+ |
| InChIKey | HEEZBCMXICYKEL-GXDHUFHOSA-N |
| XLogP | 1.45 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|