C27H21F3N2O8S — CID 89261849
dimethyl 3-[2-(trifluoromethylsulfonyloxy)benzoyl]-7,12-dihydro-6H-indolo[2,3-a]quinolizine-1,12b-dicarboxylate (PubChem CID 89261849) has the molecular formula C27H21F3N2O8S and a molecular weight of 590.53 g/mol. Its IUPAC name is dimethyl 3-[2-(trifluoromethylsulfonyloxy)benzoyl]-7,12-dihydro-6H-indolo[2,3-a]quinolizine-1,12b-dicarboxylate.
| Compound Name | dimethyl 3-[2-(trifluoromethylsulfonyloxy)benzoyl]-7,12-dihydro-6H-indolo[2,3-a]quinolizine-1,12b-dicarboxylate |
|---|---|
| PubChem CID | 89261849 |
| Molecular Formula | C27H21F3N2O8S |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | dimethyl 3-[2-(trifluoromethylsulfonyloxy)benzoyl]-7,12-dihydro-6H-indolo[2,3-a]quinolizine-1,12b-dicarboxylate |
| SMILES | COC(=O)C1=CC(C(=O)c2ccccc2OS(=O)(=O)C(F)(F)F)=CN2CCc3c([nH]c4ccccc34)C12C(=O)OC |
| InChI | InChI=1S/C27H21F3N2O8S/c1-38-24(34)19-13-15(22(33)18-8-4-6-10-21(18)40-41(36,37)27(28,29)30)14-32-12-11-17-16-7-3-5-9-20(16)31-23(17)26(19,32)25(35)39-2/h3-10,13-14,31H,11-12H2,1-2H3 |
| InChIKey | GWURQPXGDGEQLQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|