C21H22N2O3 — CID 10760322
methyl (1R,21S)-14-oxo-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,17-pentaene-1-carboxylate (PubChem CID 10760322) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl (1R,21S)-14-oxo-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,17-pentaene-1-carboxylate.
| Compound Name | methyl (1R,21S)-14-oxo-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,17-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 10760322 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl (1R,21S)-14-oxo-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,17-pentaene-1-carboxylate |
| SMILES | COC(=O)[C@@]12CCC=C3CCC(=O)N(CCc4c1[nH]c1ccccc41)[C@@H]32 |
| InChI | InChI=1S/C21H22N2O3/c1-26-20(25)21-11-4-5-13-8-9-17(24)23(19(13)21)12-10-15-14-6-2-3-7-16(14)22-18(15)21/h2-3,5-7,19,22H,4,8-12H2,1H3/t19-,21-/m0/s1 |
| InChIKey | KYRGWKNDRANXFP-FPOVZHCZSA-N |
| XLogP | 2.85 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|