C30H42N2O3Si — CID 71768177
methyl (1S,21R)-18-tri(propan-2-yl)silyloxy-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate (PubChem CID 71768177) has the molecular formula C30H42N2O3Si and a molecular weight of 506.76 g/mol. Its IUPAC name is methyl (1S,21R)-18-tri(propan-2-yl)silyloxy-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate.
| Compound Name | methyl (1S,21R)-18-tri(propan-2-yl)silyloxy-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate |
|---|---|
| PubChem CID | 71768177 |
| Molecular Formula | C30H42N2O3Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | methyl (1S,21R)-18-tri(propan-2-yl)silyloxy-3,13-diazapentacyclo[11.7.1.02,10.04,9.017,21]henicosa-2(10),4,6,8,15,17-hexaene-1-carboxylate |
| SMILES | COC(=O)[C@]12CCC(O[Si](C(C)C)(C(C)C)C(C)C)=C3C=CCN(CCc4c1[nH]c1ccccc41)[C@H]32 |
| InChI | InChI=1S/C30H42N2O3Si/c1-19(2)36(20(3)4,21(5)6)35-26-14-16-30(29(33)34-7)27-23(22-11-8-9-13-25(22)31-27)15-18-32-17-10-12-24(26)28(30)32/h8-13,19-21,28,31H,14-18H2,1-7H3/t28-,30-/m1/s1 |
| InChIKey | RHTFZYRZYMYKBX-PQHLKRTFSA-N |
| XLogP | 6.62 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|