C25H30N2O2 — CID 101093305
methyl 3-[(4S)-5,5-dimethyl-1,4,6,7-tetrahydroinden-4-yl]-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 101093305) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl 3-[(4S)-5,5-dimethyl-1,4,6,7-tetrahydroinden-4-yl]-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | methyl 3-[(4S)-5,5-dimethyl-1,4,6,7-tetrahydroinden-4-yl]-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 101093305 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | methyl 3-[(4S)-5,5-dimethyl-1,4,6,7-tetrahydroinden-4-yl]-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | COC(=O)C1CN([C@@H]2C3=C(CC=C3)CCC2(C)C)CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C25H30N2O2/c1-25(2)13-11-16-7-6-9-17(16)23(25)27-14-12-19-18-8-4-5-10-21(18)26-22(19)20(15-27)24(28)29-3/h4-6,8-10,20,23,26H,7,11-15H2,1-3H3/t20?,23-/m1/s1 |
| InChIKey | RHTJMZSGAMIVRG-GWQXNCQPSA-N |
| XLogP | 4.73 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |