C23H25N2O2 — CID 11798984
CID 11798984 (PubChem CID 11798984) has the molecular formula C23H25N2O2 and a molecular weight of 361.47 g/mol.
| Compound Name | CID 11798984 |
|---|---|
| PubChem CID | 11798984 |
| Molecular Formula | C23H25N2O2 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | — |
| SMILES | COC(=O)C1CN(C2CCC[C]3[CH][CH][CH][C]32)CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C23H25N2O2/c1-27-23(26)19-14-25(21-11-5-7-15-6-4-9-16(15)21)13-12-18-17-8-2-3-10-20(17)24-22(18)19/h2-4,6,8-10,19,21,24H,5,7,11-14H2,1H3 |
| InChIKey | KUNCHWILPFCXLQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |