C17H22N2O — CID 10286084
[(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol (PubChem CID 10286084) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol.
| Compound Name | [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol |
|---|---|
| PubChem CID | 10286084 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol |
| SMILES | C[C@@]1(CO)CCCN2CCc3c([nH]c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C17H22N2O/c1-17(11-20)8-4-9-19-10-7-13-12-5-2-3-6-14(12)18-15(13)16(17)19/h2-3,5-6,16,18,20H,4,7-11H2,1H3/t16-,17-/m0/s1 |
| InChIKey | HEIQDFFDAJWZAL-IRXDYDNUSA-N |
| XLogP | 2.86 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|