C20H26N2O3 — CID 22827346
3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-2-hydroxypropanoic acid (PubChem CID 22827346) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-2-hydroxypropanoic acid.
| Compound Name | 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22827346 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-2-hydroxypropanoic acid |
| SMILES | CC[C@]1(CC(O)C(=O)O)CCCN2CCc3c([nH]c4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C20H26N2O3/c1-2-20(12-16(23)19(24)25)9-5-10-22-11-8-14-13-6-3-4-7-15(13)21-17(14)18(20)22/h3-4,6-7,16,18,21,23H,2,5,8-12H2,1H3,(H,24,25)/t16?,18-,20-/m1/s1 |
| InChIKey | UNASKYWYFDPGRS-PUGIBVIZSA-N |
| XLogP | 3.09 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|