C20H26N2O2 — CID 153284466
methyl 2-[(1S,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]acetate (PubChem CID 153284466) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl 2-[(1S,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]acetate.
| Compound Name | methyl 2-[(1S,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]acetate |
|---|---|
| PubChem CID | 153284466 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | methyl 2-[(1S,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]acetate |
| SMILES | CC[C@@]1(CC(=O)OC)CCCN2CCc3c([nH]c4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C20H26N2O2/c1-3-20(13-17(23)24-2)10-6-11-22-12-9-15-14-7-4-5-8-16(14)21-18(15)19(20)22/h4-5,7-8,19,21H,3,6,9-13H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | WWNUKVKXRFYNMX-UXHICEINSA-N |
| XLogP | 3.82 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|