C23H32N2O2 — CID 626504
methyl 3-(1-butyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl)propanoate (PubChem CID 626504) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 3-(1-butyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl)propanoate.
| Compound Name | methyl 3-(1-butyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl)propanoate |
|---|---|
| PubChem CID | 626504 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | methyl 3-(1-butyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl)propanoate |
| SMILES | CCCCC1(CCC(=O)OC)CCCN2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C23H32N2O2/c1-3-4-12-23(14-10-20(26)27-2)13-7-15-25-16-11-18-17-8-5-6-9-19(17)24-21(18)22(23)25/h5-6,8-9,22,24H,3-4,7,10-16H2,1-2H3 |
| InChIKey | LMSAZCFQBAYYPC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|