C19H26N2O — CID 10149526
[(1R,12bR)-1-propyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol (PubChem CID 10149526) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is [(1R,12bR)-1-propyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol.
| Compound Name | [(1R,12bR)-1-propyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol |
|---|---|
| PubChem CID | 10149526 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(1R,12bR)-1-propyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]methanol |
| SMILES | CCC[C@@]1(CO)CCCN2CCc3c([nH]c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C19H26N2O/c1-2-9-19(13-22)10-5-11-21-12-8-15-14-6-3-4-7-16(14)20-17(15)18(19)21/h3-4,6-7,18,20,22H,2,5,8-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | KGSFKPDOYXTGTL-OALUTQOASA-N |
| XLogP | 3.64 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|