C19H24N2O2 — CID 70534301
3-(1-ethyl-2,3,5,6,11,11b-hexahydroindolizino[8,7-b]indol-1-yl)propanoic acid (PubChem CID 70534301) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-(1-ethyl-2,3,5,6,11,11b-hexahydroindolizino[8,7-b]indol-1-yl)propanoic acid.
| Compound Name | 3-(1-ethyl-2,3,5,6,11,11b-hexahydroindolizino[8,7-b]indol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 70534301 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-(1-ethyl-2,3,5,6,11,11b-hexahydroindolizino[8,7-b]indol-1-yl)propanoic acid |
| SMILES | CCC1(CCC(=O)O)CCN2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C19H24N2O2/c1-2-19(9-7-16(22)23)10-12-21-11-8-14-13-5-3-4-6-15(13)20-17(14)18(19)21/h3-6,18,20H,2,7-12H2,1H3,(H,22,23) |
| InChIKey | SEHWZUBEMZRGJS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|