C25H31N3O2 — CID 70417409
3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 70417409) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 70417409 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[(1R,12bS)-1-ethyl-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-1-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | CC[C@]1(CCC(=O)NCc2ccco2)CCCN2CCc3c([nH]c4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C25H31N3O2/c1-2-25(13-10-22(29)26-17-18-7-5-16-30-18)12-6-14-28-15-11-20-19-8-3-4-9-21(19)27-23(20)24(25)28/h3-5,7-9,16,24,27H,2,6,10-15,17H2,1H3,(H,26,29)/t24-,25-/m1/s1 |
| InChIKey | GRQDORSSWQRCOX-JWQCQUIFSA-N |
| XLogP | 4.95 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|