C20H26N2O4S — CID 101344153
2-[(1R,12bR)-1-ethyl-4-oxo-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-1-yl]ethyl methanesulfonate (PubChem CID 101344153) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[(1R,12bR)-1-ethyl-4-oxo-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[(1R,12bR)-1-ethyl-4-oxo-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 101344153 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[(1R,12bR)-1-ethyl-4-oxo-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-1-yl]ethyl methanesulfonate |
| SMILES | CC[C@]1(CCOS(C)(=O)=O)CCC(=O)N2CCc3c([nH]c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C20H26N2O4S/c1-3-20(11-13-26-27(2,24)25)10-8-17(23)22-12-9-15-14-6-4-5-7-16(14)21-18(15)19(20)22/h4-7,19,21H,3,8-13H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | GXEPZZIMPZHEDD-VQTJNVASSA-N |
| XLogP | 3.15 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|