C35H42N2O2Si — CID 100999689
(1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 100999689) has the molecular formula C35H42N2O2Si and a molecular weight of 550.82 g/mol. Its IUPAC name is (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 100999689 |
| Molecular Formula | C35H42N2O2Si |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-ethyl-2,3,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | CC[C@@]1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC(=O)N2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C35H42N2O2Si/c1-5-35(22-20-31(38)37-24-21-29-28-18-12-13-19-30(28)36-32(29)33(35)37)23-25-39-40(34(2,3)4,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-19,33,36H,5,20-25H2,1-4H3/t33?,35-/m0/s1 |
| InChIKey | CGIJTXURJQHVMU-XZEQTHJSSA-N |
| XLogP | 6.75 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|