C23H25N3O5 — CID 12501381
methyl 1-(2-cyano-3-methoxy-3-oxopropyl)-1-ethyl-3-oxo-5,6,11,11b-tetrahydro-2H-indolizino[8,7-b]indole-2-carboxylate (PubChem CID 12501381) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 1-(2-cyano-3-methoxy-3-oxopropyl)-1-ethyl-3-oxo-5,6,11,11b-tetrahydro-2H-indolizino[8,7-b]indole-2-carboxylate.
| Compound Name | methyl 1-(2-cyano-3-methoxy-3-oxopropyl)-1-ethyl-3-oxo-5,6,11,11b-tetrahydro-2H-indolizino[8,7-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 12501381 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | methyl 1-(2-cyano-3-methoxy-3-oxopropyl)-1-ethyl-3-oxo-5,6,11,11b-tetrahydro-2H-indolizino[8,7-b]indole-2-carboxylate |
| SMILES | CCC1(CC(C#N)C(=O)OC)C(C(=O)OC)C(=O)N2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C23H25N3O5/c1-4-23(11-13(12-24)21(28)30-2)17(22(29)31-3)20(27)26-10-9-15-14-7-5-6-8-16(14)25-18(15)19(23)26/h5-8,13,17,19,25H,4,9-11H2,1-3H3 |
| InChIKey | WOHQOJKVICBICD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|