C18H17N3O — CID 10661247
(2R,3R,5R,6R)-5-acetyl-7,17-diazapentacyclo[8.7.0.02,7.03,5.011,16]heptadeca-1(10),11,13,15-tetraene-6-carbonitrile (PubChem CID 10661247) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (2R,3R,5R,6R)-5-acetyl-7,17-diazapentacyclo[8.7.0.02,7.03,5.011,16]heptadeca-1(10),11,13,15-tetraene-6-carbonitrile.
| Compound Name | (2R,3R,5R,6R)-5-acetyl-7,17-diazapentacyclo[8.7.0.02,7.03,5.011,16]heptadeca-1(10),11,13,15-tetraene-6-carbonitrile |
|---|---|
| PubChem CID | 10661247 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2R,3R,5R,6R)-5-acetyl-7,17-diazapentacyclo[8.7.0.02,7.03,5.011,16]heptadeca-1(10),11,13,15-tetraene-6-carbonitrile |
| SMILES | CC(=O)[C@]12C[C@H]1[C@@H]1c3[nH]c4ccccc4c3CCN1[C@H]2C#N |
| InChI | InChI=1S/C18H17N3O/c1-10(22)18-8-13(18)17-16-12(6-7-21(17)15(18)9-19)11-4-2-3-5-14(11)20-16/h2-5,13,15,17,20H,6-8H2,1H3/t13-,15-,17+,18+/m0/s1 |
| InChIKey | LPYKAKVIYPLRJD-OXXUSNJHSA-N |
| XLogP | 2.57 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|