C21H22N4O — CID 102022651
(1S,14S,15R,16R,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,16-dicarbonitrile (PubChem CID 102022651) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (1S,14S,15R,16R,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,16-dicarbonitrile.
| Compound Name | (1S,14S,15R,16R,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,16-dicarbonitrile |
|---|---|
| PubChem CID | 102022651 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,14S,15R,16R,20R)-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene-14,16-dicarbonitrile |
| SMILES | C[C@@]1(C#N)OCC[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3[C@H](C#N)[C@@H]21 |
| InChI | InChI=1S/C21H22N4O/c1-21(12-23)19-13(7-9-26-21)10-17-20-15(6-8-25(17)18(19)11-22)14-4-2-3-5-16(14)24-20/h2-5,13,17-19,24H,6-10H2,1H3/t13-,17-,18+,19+,21-/m0/s1 |
| InChIKey | RVSHCMIBKFBTCW-KCGMMCBWSA-N |
| XLogP | 3.30 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|