C18H25N2O+ — CID 6954834
(1S)-1-[(4S)-2,2-dimethyloxan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 6954834) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is (1S)-1-[(4S)-2,2-dimethyloxan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | (1S)-1-[(4S)-2,2-dimethyloxan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 6954834 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | (1S)-1-[(4S)-2,2-dimethyloxan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | CC1(C)C[C@@H]([C@@H]2[NH2+]CCc3c2[nH]c2ccccc32)CCO1 |
| InChI | InChI=1S/C18H24N2O/c1-18(2)11-12(8-10-21-18)16-17-14(7-9-19-16)13-5-3-4-6-15(13)20-17/h3-6,12,16,19-20H,7-11H2,1-2H3/p+1/t12-,16-/m0/s1 |
| InChIKey | TYMZPQWLYHQVOT-LRDDRELGSA-O |
| XLogP | 2.53 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|