C20H23N3 — CID 10957714
(1R,14R,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-14-carbonitrile (PubChem CID 10957714) has the molecular formula C20H23N3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (1R,14R,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-14-carbonitrile.
| Compound Name | (1R,14R,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-14-carbonitrile |
|---|---|
| PubChem CID | 10957714 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (1R,14R,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8-tetraene-14-carbonitrile |
| SMILES | N#C[C@@]12CCCC[C@H]1CC[C@@H]1c3[nH]c4ccccc4c3CCN12 |
| InChI | InChI=1S/C20H23N3/c21-13-20-11-4-3-5-14(20)8-9-18-19-16(10-12-23(18)20)15-6-1-2-7-17(15)22-19/h1-2,6-7,14,18,22H,3-5,8-12H2/t14-,18+,20-/m0/s1 |
| InChIKey | WCLJRDVQKOETQI-QMIHWGKISA-N |
| XLogP | 4.31 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|