C25H28N2 — CID 139095869
(1S,14S,16S,18S)-16-methyl-18-phenyl-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene (PubChem CID 139095869) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (1S,14S,16S,18S)-16-methyl-18-phenyl-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene.
| Compound Name | (1S,14S,16S,18S)-16-methyl-18-phenyl-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 139095869 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (1S,14S,16S,18S)-16-methyl-18-phenyl-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-2(10),4,6,8-tetraene |
| SMILES | C[C@@H]1C[C@@H]2N3CCc4c([nH]c5ccccc45)[C@@H]3CC[C@@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C25H28N2/c1-17-15-23-25(16-17,18-7-3-2-4-8-18)13-11-22-24-20(12-14-27(22)23)19-9-5-6-10-21(19)26-24/h2-10,17,22-23,26H,11-16H2,1H3/t17-,22+,23+,25+/m1/s1 |
| InChIKey | AIVTVIZOZTYWBR-UTAGYXNQSA-N |
| XLogP | 5.60 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|