C20H22N2O2 — CID 146319507
19-methoxy-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaen-16-one (PubChem CID 146319507) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 19-methoxy-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaen-16-one.
| Compound Name | 19-methoxy-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaen-16-one |
|---|---|
| PubChem CID | 146319507 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 19-methoxy-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaen-16-one |
| SMILES | COC12C=CC(=O)CC1N1CCc3c([nH]c4ccccc34)C1CC2 |
| InChI | InChI=1S/C20H22N2O2/c1-24-20-9-6-13(23)12-18(20)22-11-8-15-14-4-2-3-5-16(14)21-19(15)17(22)7-10-20/h2-6,9,17-18,21H,7-8,10-12H2,1H3 |
| InChIKey | UBKAGBVHYGKPBU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|