C22H26N2O2 — CID 56953704
ethyl (1S,14S,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaene-17-carboxylate (PubChem CID 56953704) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl (1S,14S,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaene-17-carboxylate.
| Compound Name | ethyl (1S,14S,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaene-17-carboxylate |
|---|---|
| PubChem CID | 56953704 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethyl (1S,14S,19S)-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,17-pentaene-17-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2CC[C@H]3c4[nH]c5ccccc5c4CCN3[C@H]2CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-26-22(25)15-8-9-19-14(13-15)7-10-20-21-17(11-12-24(19)20)16-5-3-4-6-18(16)23-21/h3-6,13-14,19-20,23H,2,7-12H2,1H3/t14-,19-,20-/m0/s1 |
| InChIKey | OXLQUZBHMDWHRJ-GKCIPKSASA-N |
| XLogP | 4.13 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|