C17H20N2O2 — CID 10755492
(3S,12bS)-3-ethyl-3-hydroxy-1,4,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-2-one (PubChem CID 10755492) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (3S,12bS)-3-ethyl-3-hydroxy-1,4,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-2-one.
| Compound Name | (3S,12bS)-3-ethyl-3-hydroxy-1,4,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-2-one |
|---|---|
| PubChem CID | 10755492 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (3S,12bS)-3-ethyl-3-hydroxy-1,4,6,7,12,12b-hexahydroindolo[2,3-a]quinolizin-2-one |
| SMILES | CC[C@]1(O)CN2CCc3c([nH]c4ccccc34)[C@@H]2CC1=O |
| InChI | InChI=1S/C17H20N2O2/c1-2-17(21)10-19-8-7-12-11-5-3-4-6-13(11)18-16(12)14(19)9-15(17)20/h3-6,14,18,21H,2,7-10H2,1H3/t14-,17-/m0/s1 |
| InChIKey | FSCOWOJROOTUQN-YOEHRIQHSA-N |
| XLogP | 2.18 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|