C21H22N2O2 — CID 14521237
(1S)-17,18-dimethoxy-1,3,11,12,14,21-hexahydroyohimban (PubChem CID 14521237) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (1S)-17,18-dimethoxy-1,3,11,12,14,21-hexahydroyohimban.
| Compound Name | (1S)-17,18-dimethoxy-1,3,11,12,14,21-hexahydroyohimban |
|---|---|
| PubChem CID | 14521237 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1S)-17,18-dimethoxy-1,3,11,12,14,21-hexahydroyohimban |
| SMILES | COc1cc2c(cc1OC)CN1CCc3c([nH]c4ccccc34)[C@@H]1C2 |
| InChI | InChI=1S/C21H22N2O2/c1-24-19-10-13-9-18-21-16(15-5-3-4-6-17(15)22-21)7-8-23(18)12-14(13)11-20(19)25-2/h3-6,10-11,18,22H,7-9,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | ADXLVAIEPFQCAH-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|