C29H38ClN3O2 — CID 45481460
2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride (PubChem CID 45481460) has the molecular formula C29H38ClN3O2 and a molecular weight of 496.10 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride.
| Compound Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride |
|---|---|
| PubChem CID | 45481460 |
| Molecular Formula | C29H38ClN3O2 |
| Molecular Weight | 496.10 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine;hydrochloride |
| SMILES | CCC1CN2CCc3c([nH]c4ccccc34)C2CC1CC1NCCc2cc(OC)c(OC)cc21.Cl |
| InChI | InChI=1S/C29H37N3O2.ClH/c1-4-18-17-32-12-10-22-21-7-5-6-8-24(21)31-29(22)26(32)14-20(18)13-25-23-16-28(34-3)27(33-2)15-19(23)9-11-30-25;/h5-8,15-16,18,20,25-26,30-31H,4,9-14,17H2,1-3H3;1H |
| InChIKey | ZBKCCSAONGLYRA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.10 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|