C29H40N2O4 — CID 21152582
(2S,3R,11bS)-3-ethyl-6,9,10-trimethoxy-2-[[(1R)-7-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 21152582) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2S,3R,11bS)-3-ethyl-6,9,10-trimethoxy-2-[[(1R)-7-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | (2S,3R,11bS)-3-ethyl-6,9,10-trimethoxy-2-[[(1R)-7-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 21152582 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | (2S,3R,11bS)-3-ethyl-6,9,10-trimethoxy-2-[[(1R)-7-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | CC[C@H]1CN2C(OC)Cc3cc(OC)c(OC)cc3[C@@H]2C[C@@H]1C[C@H]1NCCc2ccc(OC)cc21 |
| InChI | InChI=1S/C29H40N2O4/c1-6-18-17-31-26(24-16-28(34-4)27(33-3)13-21(24)14-29(31)35-5)12-20(18)11-25-23-15-22(32-2)8-7-19(23)9-10-30-25/h7-8,13,15-16,18,20,25-26,29-30H,6,9-12,14,17H2,1-5H3/t18-,20-,25+,26-,29?/m0/s1 |
| InChIKey | DGCPEFMLNCUFBJ-FXGNNFOKSA-N |
| XLogP | 4.91 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |