C21H25NO4 — CID 139343003
(13aS)-2,3,10-trimethoxy-9-(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 139343003) has the molecular formula C21H25NO4 and a molecular weight of 358.45 g/mol. Its IUPAC name is (13aS)-2,3,10-trimethoxy-9-(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | (13aS)-2,3,10-trimethoxy-9-(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 139343003 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (13aS)-2,3,10-trimethoxy-9-(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | [2H]C([2H])([2H])Oc1c(OC)ccc2c1CN1CCc3cc(OC)c(OC)cc3[C@@H]1C2 |
| InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m0/s1/i4D3 |
| InChIKey | AEQDJSLRWYMAQI-NKUIMNHHSA-N |
| XLogP | 3.38 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |