C21H25NO4 — CID 175731866
2,3,9,10-tetrakis(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 175731866) has the molecular formula C21H25NO4 and a molecular weight of 367.51 g/mol. Its IUPAC name is 2,3,9,10-tetrakis(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | 2,3,9,10-tetrakis(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 175731866 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2,3,9,10-tetrakis(trideuteriomethoxy)-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])C1Cc3ccc(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])c3CN1CC2 |
| InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | AEQDJSLRWYMAQI-MGKWXGLJSA-N |
| XLogP | 3.38 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |