C19H22N2OS2 — CID 10893706
1-spiro[1,3-dithiolane-2,2'-3,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine]-3'-ylethanone (PubChem CID 10893706) has the molecular formula C19H22N2OS2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-spiro[1,3-dithiolane-2,2'-3,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine]-3'-ylethanone.
| Compound Name | 1-spiro[1,3-dithiolane-2,2'-3,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine]-3'-ylethanone |
|---|---|
| PubChem CID | 10893706 |
| Molecular Formula | C19H22N2OS2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-spiro[1,3-dithiolane-2,2'-3,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizine]-3'-ylethanone |
| SMILES | CC(=O)C1CN2CCc3c([nH]c4ccccc34)C2CC12SCCS2 |
| InChI | InChI=1S/C19H22N2OS2/c1-12(22)15-11-21-7-6-14-13-4-2-3-5-16(13)20-18(14)17(21)10-19(15)23-8-9-24-19/h2-5,15,17,20H,6-11H2,1H3 |
| InChIKey | YEWYLHSSOCVWOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|