C21H26N2O3 — CID 163075246
[(1R)-1-[(2S,3Z,12bR)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-2-hydroxyethyl] acetate (PubChem CID 163075246) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [(1R)-1-[(2S,3Z,12bR)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-2-hydroxyethyl] acetate.
| Compound Name | [(1R)-1-[(2S,3Z,12bR)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-2-hydroxyethyl] acetate |
|---|---|
| PubChem CID | 163075246 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [(1R)-1-[(2S,3Z,12bR)-3-ethylidene-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-2-hydroxyethyl] acetate |
| SMILES | C/C=C1\CN2CCc3c([nH]c4ccccc34)[C@H]2C[C@@H]1[C@H](CO)OC(C)=O |
| InChI | InChI=1S/C21H26N2O3/c1-3-14-11-23-9-8-16-15-6-4-5-7-18(15)22-21(16)19(23)10-17(14)20(12-24)26-13(2)25/h3-7,17,19-20,22,24H,8-12H2,1-2H3/b14-3+/t17-,19+,20-/m0/s1 |
| InChIKey | VURLZBDQVPJJTL-CXRHLERLSA-N |
| XLogP | 2.96 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|