C22H26N2O4 — CID 22298009
dimethyl 2-(3-ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)propanedioate (PubChem CID 22298009) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is dimethyl 2-(3-ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)propanedioate.
| Compound Name | dimethyl 2-(3-ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)propanedioate |
|---|---|
| PubChem CID | 22298009 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | dimethyl 2-(3-ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)propanedioate |
| SMILES | C=CC1CN2CCc3c([nH]c4ccccc34)C2CC1C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-13-12-24-10-9-15-14-7-5-6-8-17(14)23-20(15)18(24)11-16(13)19(21(25)27-2)22(26)28-3/h4-8,13,16,18-19,23H,1,9-12H2,2-3H3 |
| InChIKey | TWBMBWGEWDRLKW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|